(tert-Butoxycarbonyl)-L-methionine (Cat No.:R061438) is a derivative of the amino acid methionine, where the amino group is protected by a tert-butoxycarbonyl (Boc) group. This protection allows for controlled peptide synthesis by preventing undesired reactions at the amino terminus during peptide bond formation. Boc-L-Met is widely used in solid-phase peptide synthesis (SPPS) as an intermediate in the preparation of peptides. The Boc group can be removed under mild acidic conditions, revealing the free amino group of methionine. This compound is valuable in peptide-based research, drug development, and bioactive molecule synthesis.
| CAS Number | 2488-15-5 |
| Synonyms | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoic acid |
| Molecular Formula | C10H19NO4S |
| Purity | ≥95% |
| IUPAC Name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoic acid |
| InChI | InChI=1S/C10H19NO4S/c1-10(2,3)15-9(14)11-7(8(12)13)5-6-16-4/h7H,5-6H2,1-4H3,(H,11,14)(H,12,13)/t7-/m0/s1 |
| InChIKey | IMUSLIHRIYOHEV-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCSC)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |


