(S)-2-((tert-Butoxycarbonyl)amino)-5-methoxy-5-oxopentanoic acid(Cat No.:R035468)is a protected amino acid derivative used in peptide synthesis. The compound features a tert-butoxycarbonyl (Boc) group on the amino group, which shields it from unwanted reactions during synthesis, ensuring controlled incorporation into peptide sequences. The methoxy and oxo groups at the side chain position provide additional chemical functionality, making it useful for specific peptide design. The Boc group can be removed under mild acidic conditions, revealing the free amino group for further reactions or peptide elongation. This compound is valuable for advanced organic synthesis and drug development.
| CAS Number | 45214-91-3 |
| Synonyms | (2S)-5-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid |
| Molecular Formula | C11H19NO6 |
| Purity | ≥95% |
| IUPAC Name | (2S)-5-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid |
| InChI | InChI=1S/C11H19NO6/c1-11(2,3)18-10(16)12-7(9(14)15)5-6-8(13)17-4/h7H,5-6H2,1-4H3,(H,12,16)(H,14,15)/t7-/m0/s1 |
| InChIKey | OHYMUFVCRVPMEY-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCC(=O)OC)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |


