(S)-(-)-N,N-Dimethyl-1-phenethylamine(Cat No.:M088052)is a chiral tertiary amine with the molecular formula C10H15N. Structurally, it consists of a phenethyl backbone substituted with two methyl groups on the nitrogen atom, and its (S)-enantiomer confers specific stereochemical properties. This compound appears as a colorless to pale yellow liquid and is commonly used as a chiral building block or intermediate in pharmaceutical and fine chemical synthesis. Its enantiopure form is valuable in asymmetric synthesis, especially in the development of bioactive molecules and ligands for stereoselective reactions. It is typically handled under controlled laboratory conditions.
| CAS Number | 17279-31-1 |
| Molecular Formula | C10H15N |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (1S)-N,N-dimethyl-1-phenylethanamine |
| InChI | InChI=1S/C10H15N/c1-9(11(2)3)10-7-5-4-6-8-10/h4-9H,1-3H3/t9-/m0/s1 |
| InChIKey | BVURNMLGDQYNAF-VIFPVBQESA-N |
| SMILES | C[C@@H](C1=CC=CC=C1)N(C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |


