Ethyldiphenylphosphinate(CAT: M123735) is a high-purity organophosphorus compound widely utilized in chemical synthesis and advanced material research. This compound, characterized by an ethyl group and two phenyl groups bonded to a phosphinate moiety, serves as a versatile reagent and intermediate in the development of pharmaceuticals, agrochemicals, and specialty materials. Its unique chemical properties enable applications in catalytic processes, ligand design, and synthetic organic transformations. With excellent stability and reactivity, Ethyldiphenylphosphinate is a reliable choice for researchers seeking innovative solutions in organophosphorus chemistry and material science.
| CAS Number | 1733-55-7 |
| Molecular Formula | C14H15O2P |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | [ethoxy(phenyl)phosphoryl]benzene |
| InChI | InChI=1S/C14H15O2P/c1-2-16-17(15,13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12H,2H2,1H3 |
| InChIKey | QRJASDLTCXIYRK-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(C1=CC=CC=C1)C2=CC=CC=C2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |


