H-Met-OtBu.HCl(Cat No.:R061468)is a derivative of methionine where the carboxyl group is esterified with a tert-butyl group (OtBu), and the compound is in its hydrochloride salt form (HCl), enhancing its solubility and stability. The tert-butyl ester protects the carboxyl group, preventing unwanted side reactions during peptide synthesis. This modification makes H-Met-OtBu.HCl useful in peptide chemistry, particularly for drug development and bioactive peptide research. It is employed in studies related to metabolic disorders, cancer, and other therapeutic areas, providing stability and bioavailability for peptides in various research applications.
| CAS Number | 91183-71-0 |
| Synonyms | tert-butyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride |
| Molecular Formula | C9H20ClNO2S |
| Purity | ≥95% |
| IUPAC Name | tert-butyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride |
| InChI | InChI=1S/C9H19NO2S.ClH/c1-9(2,3)12-8(11)7(10)5-6-13-4;/h7H,5-6,10H2,1-4H3;1H/t7-;/m0./s1 |
| InChIKey | KZJQROCWHZGZBJ-FJXQXJEOSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CCSC)N.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |


