4,4′-(1,10-Phenanthroline-3,8-diyl)dibenzoic acid is a complex organic compound consisting of a phenanthroline core linked to two benzoic acid groups. It is used primarily in coordination chemistry and materials science for the development of metal-organic frameworks (MOFs) and other supramolecular structures. The phenanthroline moiety acts as a ligand, coordinating with metal ions, while the benzoic acid groups provide additional binding sites, enhancing structural stability. This compound is valuable in research focused on catalysis, sensing, and advanced material design.
| CAS Number | 1659300-75-0 |
| Molecular Formula | C26H16N2O4 |
| Purity | ≥95% |
| IUPAC Name | 4-[8-(4-carboxyphenyl)-1,10-phenanthrolin-3-yl]benzoic acid |
| InChI | InChI=1S/C26H16N2O4/c29-25(30)17-5-1-15(2-6-17)21-11-19-9-10-20-12-22(14-28-24(20)23(19)27-13-21)16-3-7-18(8-4-16)26(31)32/h1-14H,(H,29,30)(H,31,32) |
| InChIKey | RZPUEVQJLMTUFJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CN=C3C(=C2)C=CC4=CC(=CN=C43)C5=CC=C(C=C5)C(=O)O)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
