2-(Pyridin-4-yl)terephthalic acid (Cat.No:L004051) is a significant compound in materials science. Its unique structure, combining a pyridinyl and terephthalic acid motif, imparts specialized properties. This compound is employed in the synthesis of tailored polymers and metal-organic frameworks, with applications in electronic devices and catalysis.
| CAS Number | 1238617-40-7 |
| Molecular Formula | C13H9NO4 |
| Purity | ≥95% |
| IUPAC Name | 2-pyridin-4-ylterephthalic acid |
| InChI | InChI=1S/C13H9NO4/c15-12(16)9-1-2-10(13(17)18)11(7-9)8-3-5-14-6-4-8/h1-7H,(H,15,16)(H,17,18) |
| InChIKey | HKLXQHZNQUNGEK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)C2=CC=NC=C2)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |


