2-[2-[tert-Butyl(phenyl)phosphanyl]phenyl]-1-N,1-N,3-N,3-N-tetramethylbenzene-1,3-diamine(CAT: L001461) is a high-purity, complex organophosphorus compound widely used in advanced chemical and pharmaceutical research. Featuring a tert-butyl(phenyl)phosphanyl group attached to a phenyl ring, along with a tetramethyl-substituted benzene-1,3-diamine core, this compound serves as a versatile ligand in coordination chemistry and catalysis. Its well-defined structure and unique electronic properties make it ideal for developing metal complexes and exploring catalytic applications in organic synthesis. 2-[2-[tert-Butyl(phenyl)phosphanyl]phenyl]-1-N,1-N,3-N,3-N-tetramethylbenzene-1,3-diamine supports innovation in catalyst design, fine chemical synthesis, and material science research.
| CAS Number | 1660153-91-2 |
| Molecular Formula | C26H33N2P |
| Purity | ≥95% |
| IUPAC Name | 2-[2-[tert-butyl(phenyl)phosphanyl]phenyl]-1-N,1-N,3-N,3-N-tetramethylbenzene-1,3-diamine |
| InChI | InChI=1S/C26H33N2P/c1-26(2,3)29(20-14-9-8-10-15-20)24-19-12-11-16-21(24)25-22(27(4)5)17-13-18-23(25)28(6)7/h8-19H,1-7H3 |
| InChIKey | HTHOMNNVAUPLKK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)P(C1=CC=CC=C1)C2=CC=CC=C2C3=C(C=CC=C3N(C)C)N(C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |


