1,3-Bis(dicyclohexylphosphino)propane bis(tetrafluoroborate)(Cat No.:L033871)is a coordination compound commonly used as a ligand precursor in organometallic and catalytic chemistry. It features a propane backbone substituted with two dicyclohexylphosphine groups at the 1 and 3 positions, providing strong electron-donating phosphorus centers ideal for stabilizing metal complexes. The bis(tetrafluoroborate) salt form enhances solubility and stability, especially in polar solvents, and minimizes counterion reactivity. This compound is widely used in homogeneous catalysis, including hydrogenation and cross-coupling reactions. It typically appears as a crystalline solid and should be stored under inert, moisture-free conditions.
| CAS Number | 1002345-50-7 |
| Molecular Formula | C27H52B2F8P2 |
| Purity | ≥95% |
| IUPAC Name | dicyclohexyl(3-dicyclohexylphosphaniumylpropyl)phosphanium;ditetrafluoroborate |
| InChI | InChI=1S/C27H50P2.2BF4/c1-5-14-24(15-6-1)28(25-16-7-2-8-17-25)22-13-23-29(26-18-9-3-10-19-26)27-20-11-4-12-21-27;2*2-1(3,4)5/h24-27H,1-23H2;;/q;2*-1/p+2 |
| InChIKey | XJZAIJGNZUQTAM-UHFFFAOYSA-P |
| SMILES | [B-](F)(F)(F)F.[B-](F)(F)(F)F.C1CCC(CC1)[PH+](CCC[PH+](C2CCCCC2)C3CCCCC3)C4CCCCC4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |


