10-Methylphenothiazine-3,7-dicarbaldehyde (Cat.No:L003695) is a pivotal compound in organic synthesis. Its distinctive structure incorporates both aldehyde and phenothiazine moieties, allowing for diverse reactivity and applications. This compound serves as a valuable intermediate in the preparation of specialized organic molecules with various industrial and pharmaceutical applications.
| CAS Number | 31123-52-1 |
| Molecular Formula | C15H11NO2S |
| Purity | ≥95% |
| IUPAC Name | 10-methylphenothiazine-3,7-dicarbaldehyde |
| InChI | InChI=1S/C15H11NO2S/c1-16-12-4-2-10(8-17)6-14(12)19-15-7-11(9-18)3-5-13(15)16/h2-9H,1H3 |
| InChIKey | FCHUFBLISOGXHO-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)C=O)SC3=C1C=CC(=C3)C=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |


