Bis[p-cyanophenyl]acetylene(CAT: L002982) is a high-purity aromatic compound featuring two p-cyanophenyl groups linked by an acetylene bridge. This molecule is widely utilized in pharmaceutical, material science, and chemical research, particularly in the synthesis of advanced organic frameworks and functional materials. Its unique structure, combining electron-withdrawing cyano groups and a conjugated acetylene system, makes it valuable for developing semiconductors, liquid crystals, and optoelectronic devices. With consistent quality and excellent stability, Bis[p-cyanophenyl]acetylene supports innovative research in organic synthesis, materials development, and advanced applications in molecular electronics.
CAS Number | 5216-36-4 |
Molecular Formula | C16H8N2 |
Purity | ≥95% |
IUPAC Name | 4-[2-(4-cyanophenyl)ethynyl]benzonitrile |
InChI | InChI=1S/C16H8N2/c17-11-15-7-3-13(4-8-15)1-2-14-5-9-16(12-18)10-6-14/h3-10H |
InChIKey | RODZDHZWUDEBGU-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1C#CC2=CC=C(C=C2)C#N)C#N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |