Undecanoic acid-d21（Cat No.:S000774） is an isotopically labeled form of undecanoic acid, a saturated fatty acid with eleven carbon atoms. The “d21” designation indicates that all but one hydrogen atom in the undecanoic acid molecule is replaced with deuterium, a stable isotope of hydrogen. This isotopic labeling facilitates precise tracking of undecanoic acid metabolism and its incorporation into lipid pathways using advanced analytical techniques like mass spectrometry. Undecanoic acid-d21 serves as a valuable tool in lipid metabolism studies, aiding in elucidating pathways and understanding the role of fatty acids in cellular physiology.
| CAS Number | 60658-40-4 |
| Molecular Formula | C11HD21O2 |
| Purity | ≥95% |
| Target | Metabolic Enzyme/Protease |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-henicosadeuterioundecanoic acid |
| InChI | InChI=1S/C11H22O2/c1-2-3-4-5-6-7-8-9-10-11(12)13/h2-10H2,1H3,(H,12,13)/i1D3,2D2,3D2,4D2,5D2,6D2,7D2,8D2,9D2,10D2 |
| InChIKey | ZDPHROOEEOARMN-SLBGAMDCSA-N |
| SMILES | CCCCCCCCCCC(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
