Tropylium tetrafluoroborate（Cat No.:L006915）, is a chemical compound consisting of a tropylium cation (C7H7⁺) and tetrafluoroborate anions (BF₄⁻). It is a stable, crystalline salt, often used as a convenient source of the tropylium cation in various chemical reactions. The tropylium ion is a resonance-stabilized carbocation with a planar, aromatic structure, making it highly reactive in organic synthesis. Tropylium tetrafluoroborate is widely employed as a catalyst and reagent in Friedel-Crafts reactions, electrophilic aromatic substitutions, and other organic transformations. Its versatility makes it valuable in the creation of complex organic molecules and the development of pharmaceuticals and advanced materials.
| CAS Number | 27081-10-3 |
| Molecular Formula | C7H7BF4 |
| Purity | ≥95% |
| IUPAC Name | cyclohepta-1,3,5-triene;tetrafluoroborate |
| InChI | InChI=1S/C7H7.BF4/c1-2-4-6-7-5-3-1;2-1(3,4)5/h1-7H;/q+1;-1 |
| InChIKey | SQVQHTIKOZVGLR-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.C1=CC=C[CH+]C=C1 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
