TRIPHENYLCARBENIUM PENTACHLOROSTANNATE(CAT: M083938) is an organotin reagent used in organic synthesis experiments. TRIPHENYLCARBENIUM PENTACHLOROSTANNATE is used to catalyze the Dickens-Alder reaction of 2-OTMS-butadiene derivatives with α,β-unsaturated ketone to prepare cyclohexanone derivatives. This product is used in the research field of organic synthesis.
| CAS Number | 15414-98-9 |
| Molecular Formula | C19H15Cl5Sn |
| Purity | ≥95% |
| Storage | Desiccate at RT |
| IUPAC Name | diphenylmethylbenzene;pentachlorostannanuide |
| InChI | InChI=1S/C19H15.5ClH.Sn/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;;;;/h1-15H;5*1H;/q+1;;;;;;+4/p-5 |
| InChIKey | LJHTYNWDYRJYIH-UHFFFAOYSA-I |
| SMILES | C1=CC=C(C=C1)[C+](C2=CC=CC=C2)C3=CC=CC=C3.Cl[Sn-](Cl)(Cl)(Cl)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |


