Tridecanoic acid-d2(Cat No.:S000782) is an isotopically labeled form of tridecanoic acid, a fatty acid with 13 carbon atoms. The “d2” designation indicates that two hydrogen atoms in the tridecanoic acid molecule are replaced with deuterium, a stable isotope of hydrogen. This isotopic labeling facilitates precise tracking of tridecanoic acid metabolism and its incorporation into lipid pathways using advanced analytical techniques like mass spectrometry. Tridecanoic acid-d2 serves as a valuable tool in lipid metabolism studies, aiding in elucidating pathways and understanding the role of fatty acids in cellular physiology.
| CAS Number | 64118-44-1 |
| Molecular Formula | C13H24D2O2 |
| Purity | ≥95% |
| IUPAC Name | 2,2-dideuteriotridecanoic acid |
| InChI | InChI=1S/C13H26O2/c1-2-3-4-5-6-7-8-9-10-11-12-13(14)15/h2-12H2,1H3,(H,14,15)/i12D2 |
| InChIKey | SZHOJFHSIKHZHA-XUWBISKJSA-N |
| SMILES | CCCCCCCCCCCCC(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |


