Tetracosanoic Acid(CAT: R015826), also known as Lignoceric Acid, is a saturated long-chain fatty acid with a 24-carbon backbone. It is found in natural sources such as peanut oil, cerebrosides, and certain waxes. Tetracosanoic Acid plays a key role in the formation of sphingolipids, which are essential components of cell membranes, particularly in neural tissues. It is commonly used in biochemical research to study lipid metabolism, neurological disorders, and peroxisomal function. Additionally, it is relevant in the study of inherited metabolic disorders like adrenoleukodystrophy, where abnormal accumulation of very-long-chain fatty acids occurs.
CAS Number | 557-59-5 |
Synonyms | FL 88; FL 88 (Fatty Acid); L 88; L 88 (Fatty Acid); Lignoceric Acid; n-Tetracosanoic Acid |
Molecular Formula | C24H48O2 |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | -20°C |
IUPAC Name | tetracosanoic acid |
InChI | InChI=1S/C24H48O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24(25)26/h2-23H2,1H3,(H,25,26) |
InChIKey | QZZGJDVWLFXDLK-UHFFFAOYSA-N |
SMILES | CCCCCCCCCCCCCCCCCCCCCCCC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |