Salbutamol-d3 is a high-purity deuterated compound essential for advanced pharmaceutical research. This isotopically labeled version of Salbutamol contains three deuterium atoms, making it a critical tool for studies on bronchodilator activity, β2-adrenergic receptor mechanisms, and drug metabolism. Its stable isotope labeling ensures precise and reliable analytical results, enhancing the accuracy of pharmacokinetic and pharmacodynamic studies. With improved stability and consistency, Salbutamol-d3 integrates seamlessly into various experimental protocols, offering a robust and cost-effective solution for high-precision scientific investigations. Ideal for research and development, it supports the advancement of safer and more effective therapeutic agents.
| CAS Number | 1219798-60-3 |
| Molecular Formula | C13H18D3NO3 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| IUPAC Name | 4-[2-(tert-butylamino)-1-deuterio-1-hydroxyethyl]-2-[dideuterio(hydroxy)methyl]phenol |
| InChI | InChI=1S/C13H21NO3/c1-13(2,3)14-7-12(17)9-4-5-11(16)10(6-9)8-15/h4-6,12,14-17H,7-8H2,1-3H3/i8D2,12D |
| InChIKey | NDAUXUAQIAJITI-STOMFCJLSA-N |
| SMILES | [2H]C([2H])(C1=C(C=CC(=C1)C([2H])(CNC(C)(C)C)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |


