RUBIDIUM BICARBONATE(CAT: M086205) is a metallic bicarbonate with certain alkalinity, which is often used as chemical reagents or raw materials in the glass industry. This product is used for chemical production, laboratory research, and other scientific research and production purposes.
CAS Number | 19088-74-5 |
Molecular Formula | RbHCO3 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | hydrogen carbonate;rubidium(1+) |
InChI | InChI=1S/CH2O3.Rb/c2-1(3)4;/h(H2,2,3,4);/q;+1/p-1 |
InChIKey | KEDRKJFXBSLXSI-UHFFFAOYSA-M |
SMILES | C(=O)(O)[O-].[Rb+] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |