Metaldehyde-d16(CAT: R034594) is the deuterated form of metaldehyde, a widely used pesticide and molluscicide. It acts by causing dehydration and disrupting the nervous system of slugs and snails, leading to their death. The deuterated version, with its heavier hydrogen isotopes, is mainly used in pharmacokinetic studies and environmental research. In these applications, Metaldehyde-d16 is utilized to track the absorption, distribution, metabolism, and excretion (ADME) of the compound in various systems, offering insights into its behavior and environmental persistence. This form is especially valuable in studying the effects of pesticides while minimizing the influence of natural isotopic variations.
| CAS Number | 1219805-73-8 |
| Synonyms | 2,4,6,8-tetradeuterio-2,4,6,8-tetrakis(trideuteriomethyl)-1,3,5,7-tetraoxocane |
| Molecular Formula | C8D16O4 |
| Purity | ≥95% |
| IUPAC Name | 2,4,6,8-tetradeuterio-2,4,6,8-tetrakis(trideuteriomethyl)-1,3,5,7-tetraoxocane |
| InChI | InChI=1S/C8H16O4/c1-5-9-6(2)11-8(4)12-7(3)10-5/h5-8H,1-4H3/i1D3,2D3,3D3,4D3,5D,6D,7D,8D |
| InChIKey | GKKDCARASOJPNG-WINJLYTNSA-N |
| SMILES | [2H]C1(OC(OC(OC(O1)([2H])C([2H])([2H])[2H])([2H])C([2H])([2H])[2H])([2H])C([2H])([2H])[2H])C([2H])([2H])[2H] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |


