DL-Cystine-d6(Cat No.:S000744) is a deuterated form of DL-cystine, where six hydrogen atoms are replaced with deuterium, enhancing its molecular stability. This makes it an excellent internal standard for analytical methods like mass spectrometry and NMR spectroscopy. DL-cystine consists of two cysteine amino acids linked by a disulfide bond, important in protein structure and function. The introduction of deuterium into DL-cystine-d6 allows for more accurate pharmacokinetic and metabolic studies, aiding researchers in understanding the compound’s stability, degradation, and role in forming disulfide bonds in proteins within biological systems.
CAS Number | 352431-53-9 |
Molecular Formula | C6H6D6N2O4S2 |
Purity | ≥95% |
IUPAC Name | 2-amino-3-[(2-amino-2-carboxy-1,1,2-trideuterioethyl)disulfanyl]-2,3,3-trideuteriopropanoic acid |
InChI | InChI=1S/C6H12N2O4S2/c7-3(5(9)10)1-13-14-2-4(8)6(11)12/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12)/i1D2,2D2,3D,4D |
InChIKey | LEVWYRKDKASIDU-UFSLNRCZSA-N |
SMILES | C(C(C(=O)O)N)SSCC(C(=O)O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |