Cholic acid-13C(Cat No.:S000791) is an isotopically labeled form of cholic acid, a primary bile acid essential for lipid digestion and absorption. The “13C” notation indicates that one or more carbon atoms in the cholic acid molecule are replaced with the stable carbon isotope carbon-13. This isotopic labeling facilitates precise tracking of cholic acid metabolism and its incorporation into bile acid pathways using advanced analytical techniques like mass spectrometry. Cholic acid-13C serves as a valuable tool in metabolic studies, aiding in elucidating pathways, understanding cellular physiology, and investigating disorders related to bile acid metabolism.
| CAS Number | 52886-36-9 |
| Molecular Formula | C2313CH40O5 |
| Purity | ≥95% |
| Target | Endogenous Metabolite |
| IUPAC Name | (4R)-4-[(3R,5S,7R,8R,9S,10S,12S,13R,14S,17R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl](113C)pentanoic acid |
| InChI | InChI=1S/C24H40O5/c1-13(4-7-21(28)29)16-5-6-17-22-18(12-20(27)24(16,17)3)23(2)9-8-15(25)10-14(23)11-19(22)26/h13-20,22,25-27H,4-12H2,1-3H3,(H,28,29)/t13-,14+,15-,16-,17+,18+,19-,20+,22+,23+,24-/m1/s1/i21+1 |
| InChIKey | BHQCQFFYRZLCQQ-HFINQHRVSA-N |
| SMILES | CC(CCC(=O)O)C1CCC2C1(C(CC3C2C(CC4C3(CCC(C4)O)C)O)O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |


