4-(1,3,5-Triaza-7-phosphaadamantan-1-ium-1-yl)butane-1-sulfonate (Cat.No:L003750) is a significant compound in chemical synthesis. Its unique structure, featuring a phosphonium and sulfonate group, imparts distinctive reactivity. This compound is utilized as a valuable reagent in various organic transformations, particularly in the field of catalysis and materials science. Its versatile nature makes it a crucial component in the development of specialized molecules.
| CAS Number | 1430837-91-4 |
| Molecular Formula | C10H20N3O3PS |
| Purity | ≥95% |
| IUPAC Name | 4-(3,5-diaza-1-azonia-7-phosphatricyclo[3.3.1.13,7]decan-1-yl)butane-1-sulfonate |
| InChI | InChI=1S/C10H20N3O3PS/c14-18(15,16)4-2-1-3-13-6-11-5-12(7-13)9-17(8-11)10-13/h1-10H2 |
| InChIKey | KGJWBSOVUYDJAT-UHFFFAOYSA-N |
| SMILES | C1N2C[N+]3(CN1CP(C2)C3)CCCCS(=O)(=O)[O-] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |


