3,6-Dibromobenzene-1,2-diamine(Cat No.:L033099)is an aromatic compound featuring two amino groups at the 1- and 2-positions and bromine atoms at the 3- and 6-positions on a benzene ring. This substitution pattern creates a highly functionalized intermediate useful in organic synthesis, particularly for building complex heterocyclic and bioactive molecules. The amino groups enable coupling reactions and cyclizations, while the bromine atoms serve as reactive sites for cross-coupling reactions like Suzuki or Buchwald–Hartwig amination. It is often employed in pharmaceutical research, dye development, and materials science for synthesizing structurally diverse aromatic systems.
CAS Number | 69272-50-0 |
Molecular Formula | C6H6Br2N2 |
Purity | ≥95% |
IUPAC Name | 3,6-dibromobenzene-1,2-diamine |
InChI | InChI=1S/C6H6Br2N2/c7-3-1-2-4(8)6(10)5(3)9/h1-2H,9-10H2 |
InChIKey | VPMJBJSLTPBZLR-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C(=C1Br)N)N)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |