2-(((1R,2S,5R)-2-Isopropyl-5-methylcyclohexyl)oxy)acetic acid(Cat No.:L023079)is a chiral carboxylic acid derivative featuring a menthol-based cyclohexyl ring substituted with an isopropyl and a methyl group, providing steric bulk and hydrophobic character. The ether linkage to acetic acid imparts both lipophilic and polar functionality, making the compound useful in medicinal chemistry, especially for designing bioactive molecules or drug delivery agents. Its defined stereochemistry enhances interaction specificity with biological targets. This compound is also explored for applications in flavor, fragrance, and agrochemical synthesis, leveraging its menthol backbone for sensory or functional modulation.
| CAS Number | 40248-63-3 |
| Molecular Formula | C12H22O3 |
| Purity | ≥95% |
| IUPAC Name | 2-(5-methyl-2-propan-2-ylcyclohexyl)oxyacetic acid |
| InChI | InChI=1S/C12H22O3/c1-8(2)10-5-4-9(3)6-11(10)15-7-12(13)14/h8-11H,4-7H2,1-3H3,(H,13,14) |
| InChIKey | CILPHQCEVYJUDN-UHFFFAOYSA-N |
| SMILES | CC1CCC(C(C1)OCC(=O)O)C(C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |


