(-)-(1R)-Menthyl chloroformate (Cat No.:R034213) is a chiral chemical compound. It consists of a methyl group and a chloroformate moiety, bearing (1R) absolute configuration. This compound is valuable in organic synthesis, particularly for the creation of optically pure derivatives. Its chiral menthyl group imparts enantioselectivity, making it a versatile reagent for preparing enantiomerically enriched compounds. This compound’s role in chiral transformations contributes to the advancement of asymmetric synthesis, enabling the production of molecules with precise stereochemistry. Its stereoselective nature supports the development of chirally pure compounds, often used in pharmaceutical, agrochemical, and materials research.
| CAS Number | 14602-86-9 |
| Synonyms | Carbonochloridic Acid (1R,2S,5R)-5-Methyl-2-(1-methylethyl)cyclohexyl Ester; (-)-(1R,2S,5R)-Menthyl Chloroformate; (-)-(R)-Menthyl Chloroformate; (-)-Menthyl Chloroformate; (1R,2S,5R)-2-Isopropyl-5-methylcyclohexyl Chloroformate; (1R,2S,5R)-Menthyl C |
| Molecular Formula | C11H19ClO2 |
| Purity | ≥95% |
| Storage | 2-8°C |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] carbonochloridate |
| InChI | InChI=1S/C11H19ClO2/c1-7(2)9-5-4-8(3)6-10(9)14-11(12)13/h7-10H,4-6H2,1-3H3/t8-,9+,10-/m1/s1 |
| InChIKey | KIUPCUCGVCGPPA-KXUCPTDWSA-N |
| SMILES | CC1CCC(C(C1)OC(=O)Cl)C(C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |


