1,1′-Bis[bis(1,1-dimethylethyl)phosphino]ferrocene(Cat No.:L020656), commonly abbreviated as dtbpf, is a bulky, electron-rich bidentate diphosphine ligand derived from ferrocene. It features two di-tert-butylphosphino groups attached at the 1 and 1′ positions of the ferrocene backbone, providing a rigid, symmetrical framework with substantial steric hindrance. This ligand is widely used in coordination and organometallic chemistry, particularly in palladium- and nickel-catalyzed cross-coupling reactions such as Suzuki, Stille, and Negishi couplings. Its strong electron-donating properties enhance catalyst stability and activity, making it valuable in the synthesis of complex organic molecules and pharmaceuticals.
| CAS Number | 84680-95-5 |
| Molecular Formula | C26H44FeP2 |
| Purity | ≥95% |
| IUPAC Name | ditert-butyl(cyclopenta-1,4-dien-1-yl)phosphane;iron(2+) |
| InChI | InChI=1S/2C13H22P.Fe/c2*1-12(2,3)14(13(4,5)6)11-9-7-8-10-11;/h2*7-10H,1-6H3;/q2*-1;+2 |
| InChIKey | WDUDHEOUGWAKFD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)P(C1=C[CH-]C=C1)C(C)(C)C.CC(C)(C)P(C1=C[CH-]C=C1)C(C)(C)C.[Fe+2] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |


