Bis(di-tert-butyl(4-dimethylaminophenyl)phosphine)dichloropalladium(II)(Cat No.:L040198)is a square planar palladium(II) complex widely used as a catalyst in cross-coupling reactions such as Suzuki, Heck, and Buchwald–Hartwig aminations. The bulky di-tert-butyl(4-dimethylaminophenyl)phosphine ligands provide strong electron donation and steric protection, enhancing the complex’s stability and catalytic efficiency. The presence of two chloride ligands completes the coordination sphere, aiding solubility and ligand exchange in reaction media. This palladium complex is especially valued for promoting C–C and C–N bond formation under mild conditions, making it a versatile tool in pharmaceutical and material synthesis.
CAS Number | 887919-35-9 |
Molecular Formula | C32H56Cl2N2P2Pd |
Purity | ≥95% |
IUPAC Name | 4-ditert-butylphosphanyl-N,N-dimethylaniline;dichloropalladium |
InChI | InChI=1S/2C16H28NP.2ClH.Pd/c2*1-15(2,3)18(16(4,5)6)14-11-9-13(10-12-14)17(7)8;;;/h2*9-12H,1-8H3;2*1H;/q;;;;+2/p-2 |
InChIKey | DWOZNANUEDYIOF-UHFFFAOYSA-L |
SMILES | CC(C)(C)P(C1=CC=C(C=C1)N(C)C)C(C)(C)C.CC(C)(C)P(C1=CC=C(C=C1)N(C)C)C(C)(C)C.Cl[Pd]Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |