5-(2-Furyl)-1,3-cyclohexanedione(CAT: M121851) is a high-purity heterocyclic compound characterized by a furan ring linked to a cyclohexanedione framework. This versatile molecule is widely utilized in pharmaceutical research, organic synthesis, and materials science. Its unique structure makes it a valuable intermediate for designing bioactive molecules, exploring new chemical pathways, and developing advanced functional materials. With excellent stability and precise formulation, 5-(2-Furyl)-1,3-cyclohexanedione ensures consistent performance, making it a reliable choice for researchers engaged in drug discovery, fine chemical production, and innovative chemical synthesis projects.
| CAS Number | 1774-11-4 |
| Molecular Formula | C10H10O3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 5-(furan-2-yl)cyclohexane-1,3-dione |
| InChI | InChI=1S/C10H10O3/c11-8-4-7(5-9(12)6-8)10-2-1-3-13-10/h1-3,7H,4-6H2 |
| InChIKey | FYLTVHCMIYGVPZ-UHFFFAOYSA-N |
| SMILES | C1C(CC(=O)CC1=O)C2=CC=CO2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |


