2-Methylterephthalic acid is an aromatic dicarboxylic acid featuring a methyl group attached to the terephthalic acid framework. This compound is significant in the production of polyesters, particularly in the synthesis of polyethylene terephthalate (PET) and other polymeric materials. Its presence enhances the properties of the resulting polymers, including thermal stability and mechanical strength. Additionally, 2-methylterephthalic acid is studied for its potential applications in the development of environmentally friendly materials and as a building block in organic synthesis, expanding its industrial relevance.
| CAS Number | 5156-01-4 |
| Molecular Formula | C9H8O4 |
| Purity | ≥95% |
| IUPAC Name | 2-methylterephthalic acid |
| InChI | InChI=1S/C9H8O4/c1-5-4-6(8(10)11)2-3-7(5)9(12)13/h2-4H,1H3,(H,10,11)(H,12,13) |
| InChIKey | UFMBOFGKHIXOTA-UHFFFAOYSA-N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |


