Barium Trifluoromethanesulfonate(Cat No.:L007081), is an inorganic compound containing barium ions (Ba²⁺) and trifluoromethanesulfonate anions (CF₃SO₃⁻). It is utilized as a powerful catalyst in various organic transformations, including esterifications, rearrangements, and nucleophilic substitutions. Barium trifluoromethane sulfonate is highly effective due to the high solubility and stability of its salts, promoting reactions with high yields. Its catalytic activity makes it valuable in organic synthesis, aiding in the preparation of complex molecules, pharmaceuticals, and specialty chemicals. Researchers and chemists use this compound to streamline chemical processes, enhancing the efficiency of diverse synthetic routes in both laboratory and industrial settings.
| CAS Number | 2794-60-7 |
| Molecular Formula | C2BaF6O6S2 |
| Purity | ≥95% |
| Storage | Room Temperature |
| IUPAC Name | barium(2+);trifluoromethanesulfonate |
| InChI | InChI=1S/2CHF3O3S.Ba/c2*2-1(3,4)8(5,6)7;/h2*(H,5,6,7);/q;;+2/p-2 |
| InChIKey | DXJURUJRANOYMX-UHFFFAOYSA-L |
| SMILES | C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].[Ba+2] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |


