6,6′-Bis((S)-4-phenyl-4,5-dihydrooxazol-2-yl)-2,2′-bipyridine(CAT: L003251) is a high-purity chiral ligand widely utilized in asymmetric catalysis and coordination chemistry. Featuring two oxazoline rings attached to a bipyridine backbone, this compound is particularly valuable in enantioselective catalytic processes such as hydrogenation, cycloaddition, and cross-coupling reactions. Its well-defined chiral structure provides precise control over stereoselectivity in chemical transformations, making it essential for pharmaceutical research and fine chemical synthesis. With excellent stability and versatility, 6,6′-Bis((S)-4-phenyl-4,5-dihydrooxazol-2-yl)-2,2′-bipyridine ensures reliable performance in advanced research and innovative synthetic applications.
| CAS Number | 273216-89-0 |
| Molecular Formula | C28H22N4O2 |
| Purity | ≥95% |
| IUPAC Name | (4S)-4-phenyl-2-[6-[6-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]pyridin-2-yl]pyridin-2-yl]-4,5-dihydro-1,3-oxazole |
| InChI | InChI=1S/C28H22N4O2/c1-3-9-19(10-4-1)25-17-33-27(31-25)23-15-7-13-21(29-23)22-14-8-16-24(30-22)28-32-26(18-34-28)20-11-5-2-6-12-20/h1-16,25-26H,17-18H2/t25-,26-/m1/s1 |
| InChIKey | IGCOZILWCDLYHM-CLJLJLNGSA-N |
| SMILES | C1[C@@H](N=C(O1)C2=CC=CC(=N2)C3=NC(=CC=C3)C4=N[C@H](CO4)C5=CC=CC=C5)C6=CC=CC=C6 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |


