(2S,3S)-1,4-Dichlorobutane-diol Sulfate (Cat. No: R004079) is a chiral compound that can be used as a pharmaceutical organic raw material for drug preparation in the fine chemical industry and is widely used in scientific research.
| CAS Number | 190850-76-1 |
| Synonyms | (4S,5S)-4,5-Bis(chloromethyl)-1,3,2-dioxathiolane 2,2-dioxide;?(4S-trans)-4,5-Bis(chloromethyl)-1,3,2-dioxathiolane 2,2-dioxide; |
| Molecular Formula | C4H6Cl2O4S |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (4S,5S)-4,5-bis(chloromethyl)-1,3,2-dioxathiolane 2,2-dioxide |
| InChI | InChI=1S/C4H6Cl2O4S/c5-1-3-4(2-6)10-11(7,8)9-3/h3-4H,1-2H2/t3-,4-/m1/s1 |
| InChIKey | RIWLWZZVVQCXJG-QWWZWVQMSA-N |
| SMILES | C(C1C(OS(=O)(=O)O1)CCl)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |


