Strontium acetate(Cat No.:L006937), is a chemical compound. It is a white, crystalline powder, highly soluble in water. Strontium acetate finds applications in various industries, including the production of glass, ceramics, and fireworks, where it imparts red coloration. It is also used in some chemical research processes. Additionally, strontium acetate has potential applications in medicine, specifically in the treatment of osteoporosis, due to its role as a strontium supplement. Its unique properties make it valuable in diverse fields, contributing to the development of materials, technologies, and medical research.
CAS Number | 543-94-2 |
Molecular Formula | C4H6O4Sr |
Purity | ≥95% |
IUPAC Name | strontium;diacetate |
InChI | InChI=1S/2C2H4O2.Sr/c2*1-2(3)4;/h2*1H3,(H,3,4);/q;;+2/p-2 |
InChIKey | RXSHXLOMRZJCLB-UHFFFAOYSA-L |
SMILES | CC(=O)[O-].CC(=O)[O-].[Sr+2] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |