Thymidine-15N2 is a high-purity isotopically labeled compound crucial for advanced pharmaceutical and biochemical research. This version of Thymidine incorporates two nitrogen-15 atoms, making it essential for studies on DNA synthesis, nucleic acid metabolism, and cellular replication. Its stable isotope labeling ensures precise and reliable analytical results, enhancing the accuracy of metabolic and pharmacokinetic studies. With improved stability and consistency, Thymidine-15N2 integrates seamlessly into various experimental protocols, offering a robust and cost-effective solution for high-precision scientific investigations. Ideal for research and development, it supports the advancement of safer and more effective therapeutic agents.
Molecular Formula | C10H1415N2O5 |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
IUPAC Name | 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methyl(1,3-15N2)pyrimidine-2,4-dione |
InChI | InChI=1S/C10H14N2O5/c1-5-3-12(10(16)11-9(5)15)8-2-6(14)7(4-13)17-8/h3,6-8,13-14H,2,4H2,1H3,(H,11,15,16)/t6-,7+,8+/m0/s1/i11+1,12+1 |
InChIKey | IQFYYKKMVGJFEH-IPSWRTTCSA-N |
SMILES | CC1=C[15N](C(=O)[15NH]C1=O)[C@H]2C[C@@H]([C@H](O2)CO)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |