Taurine-13C2 is a high-purity isotopically labeled compound essential for advanced pharmaceutical and biochemical research. This version of Taurine, labeled with two carbon-13 atoms, is crucial for studies involving amino acid metabolism, osmoregulation, and cellular protection mechanisms. Featuring stable isotope labeling, it ensures precise and reliable analytical results. Its advanced formulation provides enhanced stability and consistency, making it suitable for various experimental setups. Ideal for biochemistry research and drug development, Taurine-13C2 integrates seamlessly into existing protocols, offering a robust and cost-effective solution for high-precision scientific investigations.
CAS Number | 70155-54-3 |
Molecular Formula | 13C2H7NO3S |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
IUPAC Name | 2-amino(1,2-13C2)ethanesulfonic acid |
InChI | InChI=1S/C2H7NO3S/c3-1-2-7(4,5)6/h1-3H2,(H,4,5,6)/i1+1,2+1 |
InChIKey | XOAAWQZATWQOTB-ZDOIIHCHSA-N |
SMILES | [13CH2]([13CH2]S(=O)(=O)O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |