(+)-cis-Abienol(CAT: R040617) is a naturally occurring diterpene alcohol found in the resins of certain coniferous trees, particularly Abies balsamea (balsam fir) and Nicotiana species. It is widely used in the fragrance and cosmetics industry due to its pleasant, woody aroma and its function as a precursor in the synthesis of ambroxide, a key ingredient in high-end perfumes. In addition to its olfactory value, (+)-cis-Abienol has shown antimicrobial and anti-inflammatory properties, making it a subject of interest in natural product chemistry and cosmetic formulation. Its sustainable, plant-derived origin adds appeal for eco-conscious product development.
CAS Number | 17990-16-8 |
Synonyms | (1R,2R,4aS,8aS)-2,5,5,8a-tetramethyl-1-[(2Z)-3-methylpenta-2,4-dienyl]-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol |
Molecular Formula | C20H34O |
Purity | ≥95% |
IUPAC Name | (1R,2R,4aS,8aS)-2,5,5,8a-tetramethyl-1-[(2Z)-3-methylpenta-2,4-dienyl]-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol |
InChI | InChI=1S/C20H34O/c1-7-15(2)9-10-17-19(5)13-8-12-18(3,4)16(19)11-14-20(17,6)21/h7,9,16-17,21H,1,8,10-14H2,2-6H3/b15-9-/t16-,17+,19-,20+/m0/s1 |
InChIKey | ZAZVCYBIABTSJR-SZAPHMHZSA-N |
SMILES | CC(=CCC1C2(CCCC(C2CCC1(C)O)(C)C)C)C=C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |