L-Lysine-d4 dihydrochloride(Cat No.:S000720) is a deuterated form of L-lysine dihydrochloride, where four hydrogen atoms are replaced with deuterium, enhancing its molecular stability. This modification makes it highly useful as an internal standard for precise analytical techniques such as mass spectrometry and NMR spectroscopy. L-lysine is an essential amino acid important for protein synthesis and various metabolic processes. The deuterium in L-Lysine-d4 dihydrochloride allows for more accurate pharmacokinetic and metabolic studies, enabling researchers to better understand the absorption, distribution, and metabolic pathways of lysine in biological systems.
CAS Number | 203633-22-1 |
Molecular Formula | C6H12D4Cl2N2O2 |
Purity | ≥95% |
InChI | 1S/C6H14N2O2.2ClH/c7-4-2-1-3-5(8)6(9)10;;/h5H,1-4,7-8H2,(H,9,10);2*1H/t5-;;/m0../s1/i1D2,2D2 |
InChIKey | JBBURJFZIMRPCZ-RGTYBCOQSA-N |
SMILES | [2H]C([2H])(C[C@@H](C(=O)O)N)C([2H])([2H])CN.Cl.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |