L-Aspartic acid-1,4-13C2(Cat No.:S000734) is a labeled form of L-aspartic acid, where the first and fourth carbon atoms are enriched with carbon-13. This specific isotopic labeling enhances its detectability for studies using NMR spectroscopy and mass spectrometry, providing a specialized tool for tracing and analyzing metabolic pathways involving aspartic acid. L-aspartic acid plays a crucial role in the synthesis of other amino acids and neurotransmitter metabolism. The targeted carbon-13 labeling at positions 1 and 4 enables researchers to investigate specific aspects of its incorporation into proteins and its behavior in various biochemical processes.
CAS Number | 101247-29-4 |
Molecular Formula | C213C2H7NO4 |
Purity | ≥95% |
Target | Endogenous Metabolite |
IUPAC Name | 2-amino(1,4-13C2)butanedioic acid |
InChI | InChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9)/i3+1,4+1 |
InChIKey | CKLJMWTZIZZHCS-CQDYUVAPSA-N |
SMILES | C(C(C(=O)O)N)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |