DL-Tyrosine-13C9,15N（Cat No.:S000732） is a labeled form of DL-Tyrosine where all nine carbon atoms are enriched with carbon-13 and the nitrogen atom is enriched with nitrogen-15, significantly enhancing its detectability in analytical studies like NMR spectroscopy and mass spectrometry. This isotopic labeling is crucial for detailed studies of protein synthesis and enzyme interactions involving tyrosine. DL-Tyrosine is a non-essential amino acid used in protein biosynthesis. The dual labeling allows for precise tracking of tyrosine’s incorporation into proteins and its metabolism, providing insights into biological pathways and molecular mechanisms.
| CAS Number | 202407-26-9 |
| Molecular Formula | 13C9H1115NO3 |
| Purity | ≥95% |
| IUPAC Name | (2S)-2-(15N)azanyl-3-(4-hydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)(1,2,3-13C3)propanoic acid |
| InChI | InChI=1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/t8-/m0/s1/i1+1,2+1,3+1,4+1,5+1,6+1,7+1,8+1,9+1,10+1 |
| InChIKey | OUYCCCASQSFEME-CMLFETTRSA-N |
| SMILES | C1=CC(=CC=C1CC(C(=O)O)N)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
