D-α-Phenyl-glycine-d5(Cat No.:S000730) is a deuterated version of D-α-Phenyl-glycine, where five hydrogen atoms, specifically on the phenyl ring, are replaced with deuterium, increasing its molecular stability. This modification is particularly useful for serving as an internal standard in sophisticated analytical methods like mass spectrometry and NMR spectroscopy. D-α-Phenyl-glycine is a derivative of the amino acid phenylalanine and is used in the synthesis of various pharmaceuticals. The incorporation of deuterium enhances the ability of researchers to conduct precise pharmacokinetic and metabolic studies, providing clearer insights into the behavior of this compound in chemical and biological systems.
| CAS Number | 1246817-98-0 |
| Molecular Formula | C8H4D5NO2 |
| Purity | ≥95% |
| IUPAC Name | (2R)-2-amino-2-(2,3,4,5,6-pentadeuteriophenyl)acetic acid |
| InChI | InChI=1S/C8H9NO2/c9-7(8(10)11)6-4-2-1-3-5-6/h1-5,7H,9H2,(H,10,11)/t7-/m1/s1/i1D,2D,3D,4D,5D |
| InChIKey | ZGUNAGUHMKGQNY-MWQKFOQQSA-N |
| SMILES | C1=CC=C(C=C1)C(C(=O)O)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |


