N-Boc-L-glutamic acid(Cat No.:R061594)is a derivative of L-glutamic acid, where a tert-butoxycarbonyl (Boc) group is attached to the amino group of the glutamic acid side chain. The Boc group acts as a protective group during peptide synthesis, preventing unwanted reactions at the amino group. It can be removed under mild acidic conditions to reveal the free amino group for further modifications. N-Boc-L-glutamic acid is commonly used in peptide synthesis, especially when working with glutamic acid residues, allowing for controlled incorporation into peptides and proteins for studies on structure, function, and biological activity.
| CAS Number | 2419-94-5 |
| Synonyms | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioic acid |
| Molecular Formula | C10H17NO6 |
| Purity | ≥95% |
| IUPAC Name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioic acid |
| InChI | InChI=1S/C10H17NO6/c1-10(2,3)17-9(16)11-6(8(14)15)4-5-7(12)13/h6H,4-5H2,1-3H3,(H,11,16)(H,12,13)(H,14,15)/t6-/m0/s1 |
| InChIKey | AQTUACKQXJNHFQ-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCC(=O)O)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |


